ChemNet > CAS > 301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
| produktnavn |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
| Synonymer |
4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
| Molekylær Formel |
C9H13BO3 |
| Molekylvekt |
180.0087 |
| InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
| CAS-nummer |
301699-39-8 |
| Molecular Structure |
|
| Tetthet |
1.11g/cm3 |
| Smeltepunkt |
235-242℃ |
| Kokepunkt |
335.8°C at 760 mmHg |
| Brytningsindeks |
1.517 |
| Flammepunktet |
156.9°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
